On Target PDE4B_HUMAN 0.35928145/CHEMBL371089
For the given ligand A26, we have found in our database that, being scored 0.35928145, the most similar ligand is CHEMBL371089. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL371089 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | CC(C)NC(=O)\C(=C\c1cccc(c1)c2cc(cc3cccnc23)C(C)C)\c4ccc(cc4)S(=O)(=O)C |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00002002 0080d200 00124100 00910610 00041001 04000008 80100080 00000400 01800080 00480840 08202104 60009000 01008802 00410000 c0200042 800c000c 24020400 02001104 44218000 00882200 c0000000 18248608 30880000 89400019 00040001 80080080 08482200 40010061 04404000 00260003 04042000 00010620 |