On Target ACM4_HUMAN 0.31875/CHEMBL543177
For the given ligand A26, we have found in our database that, being scored 0.31875, the most similar ligand is CHEMBL543177. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL543177 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | Cl.CCN1CCC(=C(C1)C(=O)OCc2ccccc2)c3ccccc3 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00000010 08008200 00100100 00010600 00000010 00004800 82180180 30000400 01800900 005808c8 48300000 40009000 0c008102 00090000 00000002 020c0008 20220400 02000140 2081801a 00800201 00000120 18000aa0 01008080 00400010 00001401 80002400 00482000 50010420 00400200 0006040a 44000000 02022610 |