On Target NOS1_HUMAN 0.3063063/CHEMBL542431
For the given ligand A26, we have found in our database that, being scored 0.3063063, the most similar ligand is CHEMBL542431. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL542431 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | Cl.CC(=N)Nc1ccc(CO)cc1 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00004002 00000810 00000100 00090600 00000000 00004000 00000000 00000000 00000100 00000843 00200004 40008000 00000000 00008000 00000040 00080008 00040000 02000000 08000000 00000000 40120000 08000020 20000000 00400000 00000000 80000000 40000000 00000080 00008010 00060000 40000000 04020200 |