On Target ALDR_HUMAN 0.31764707/CHEMBL2260153
For the given ligand A26, we have found in our database that, being scored 0.31764707, the most similar ligand is CHEMBL2260153. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL2260153 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | OC(=O)CN1C(=O)S\C(=C\c2ccc(cc2)c3ccccc3)\C1=O |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00002000 0000c500 20004100 08110604 00010080 00002800 80300280 00001400 01c00100 8a484841 40a01800 c000a200 02088002 000d0000 00000002 00080008 34024400 22000300 44018040 11800108 01020010 08000e04 12000000 04400008 00000000 80000020 00486004 40010150 00404000 40060001 2c80c010 83090280 |