On Target NMDE2_HUMAN 0.30252102/CHEMBL158874
For the given ligand A26, we have found in our database that, being scored 0.30252102, the most similar ligand is CHEMBL158874. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL158874 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | N=C(NCc1ccccc1)\C=C\c2ccccc2 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00000000 00008000 00000100 00010600 00000000 00000000 80100080 12001400 00000000 00400853 00200000 40008000 00000802 00010000 00000402 00100000 20000400 02000100 00000000 00800000 00000000 08008000 00000000 00400000 00000000 c0000000 40482200 d0010000 00400110 00060000 04040000 00000200 |