On Target PRGR_HUMAN 0.5121951/CHEMBL93463
For the given ligand A26, we have found in our database that, being scored 0.5121951, the most similar ligand is CHEMBL93463. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL93463 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | CC1=CC(C)(C)Nc2ccc(cc12)c3ccccc3 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00006202 00008800 00000300 00010600 00000001 00000040 80000080 00000400 00000000 00580840 08200004 60008008 00000000 00018000 00020042 00080008 20068400 02401100 0c000000 00800000 40100000 08020000 300a8000 00400010 01000000 82000080 00402000 400192c1 0048c000 00260002 04000000 20004600 |