On Target DRD4_HUMAN 0.38356164/CHEMBL338606
For the given ligand A26, we have found in our database that, being scored 0.38356164, the most similar ligand is CHEMBL338606. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL338606 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | COc1ccccc1N2CCN(CCCCNC(=O)\C=C\c3ccc(F)cc3)CC2 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00004002 00009008 20100128 06010600 80001000 00000010 82100080 20000400 01a00000 00400ac0 00200004 40028000 00008002 00013000 01080043 00004008 20040400 02000100 08018000 00920201 40100000 38040600 20000021 0240801a 00000000 80000000 20482000 50010081 08408200 00068001 04000800 02000200 |