On Target PGH2_HUMAN 0.4774775/CHEMBL23588
For the given ligand A26, we have found in our database that, being scored 0.4774775, the most similar ligand is CHEMBL23588. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL23588 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | OC(=O)c1ccccc1Nc2cccc(c2)C(F)(F)F |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00000002 00000800 00100100 00010200 00000000 00014000 00000410 00000040 00802100 00000850 00200004 40009004 04008000 01000000 00020040 00080008 00040000 02000000 0800800a 00000010 41000000 08020a20 20000000 00400004 00040000 80000000 02000000 90001080 00408000 00260000 c0100000 00000200 |