On Target ACE_HUMAN 0.2892562/CHEMBL98
For the given ligand A26, we have found in our database that, being scored 0.2892562, the most similar ligand is CHEMBL98. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL98 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | ONC(=O)CCCCCCC(=O)Nc1ccccc1 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00014002 01000010 40100000 00000600 20000000 00002000 04000000 00000000 00000000 000008c0 00280004 40019000 0400800c 00100000 00020040 00000010 00040000 00000000 08002000 00040001 40100000 18000610 20002000 00100010 00000000 00000000 00000000 10000080 00008000 00060005 00020000 00000200 |