On Target TLR4_HUMAN 0.29710144/CHEMBL1223752
For the given ligand A26, we have found in our database that, being scored 0.29710144, the most similar ligand is CHEMBL1223752. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL1223752 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | CC(C)CC(=O)Nc1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 04014002 01000008 20100008 00010700 20081000 02002000 02000000 00000008 00000000 000008c0 00280004 40009000 0480802a 00900000 11030041 00082008 00860000 00000000 0a402000 00020001 40100000 18000e00 31002000 00000010 00000000 00000000 00040000 10000080 00008200 00060001 00020000 10000200 |