On Target OPRD_HUMAN 0.37414965/CHEMBL1939743
For the given ligand A26, we have found in our database that, being scored 0.37414965, the most similar ligand is CHEMBL1939743. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL1939743 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | CCN(CC)C(=O)c1ccc(cc1)[C@@H](N2CCN(CCOC)CC2)c3cccc(NC(=O)C4CC4)c3 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 18004002 00000800 40100100 44010600 24000080 08002000 00000000 03001000 00c00100 000908d0 08280004 40009800 84008802 01102000 00121440 00080008 10040000 02000000 08000000 00000001 44100000 38028600 32002020 0240001c 00040000 e0000000 00000000 d0000081 08408380 00060003 80040000 00000600 |