On Target FYN_HUMAN 0.4516129/CHEMBL2002702
For the given ligand A26, we have found in our database that, being scored 0.4516129, the most similar ligand is CHEMBL2002702. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL2002702 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | Cc1cc(C)c(C=C2C(=O)Nc3ccccc23)[nH]1 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 10084202 00008800 00100100 10010e10 20000021 04000000 80000080 08024408 01800100 28480850 08280104 60009008 01008000 00318002 c0020142 0004000c 24040400 12000104 08218000 00800000 41100000 18208600 20822000 81410011 00040000 82000201 08402010 40011280 04408004 00060003 24002200 20000620 |