On Target ESR1_HUMAN 0.42281878/CHEMBL3621988
For the given ligand A26, we have found in our database that, being scored 0.42281878, the most similar ligand is CHEMBL3621988. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL3621988 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | Nc1cc(F)ccc1NC(=O)c2ccc(CNC(=O)\C=C\c3cccnc3)cc2 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00004002 00808800 00104100 42010610 01041004 00000010 80100000 02001400 01800100 00406840 00280004 6000c000 80008802 00111000 00040442 00440004 20040400 02004104 08218000 00a00002 c0100000 08028600 20812000 0040000c 00040000 c0000081 08482220 c0010081 00408100 00068001 a4041000 00000200 |