On Target PTGES_HUMAN 0.4117647/CHEMBL1086884
For the given ligand A26, we have found in our database that, being scored 0.4117647, the most similar ligand is CHEMBL1086884. Check out the elaboration below.
| A26 (Given Ligand) | CHEMBL1086884 (Similar Ligand) |
|---|---|
| O=C(O)c1ccccc1NC(=O)/C=C/c3ccc(c2cccc(C(F)(F)F)c2)cc3 | Cc1ccc(cc1C)c2ccc(NC(=O)C3=C(O)c4ccccc4S(=O)(=O)N3)cc2 |
|
|
|
|
|
|
| 10016202 00008800 00100100 00010600 00000001 00014040 80000480 00080400 01800100 00400850 00280084 6000900a 04008000 01110000 00020042 00080008 20060400 02001100 0c018000 10800008 41100000 08020e20 30002000 00400004 00004000 80000000 00402010 d00110c1 0040c000 00060001 c4100000 00000200 | 00406292 80808800 01400120 01b10600 00088001 00004008 80020090 00002c00 81800180 00400a40 00286004 6020a008 a0008000 00318103 80300042 00089008 20062c80 12005101 0c678000 90836400 c0140000 28020621 30006000 28400028 02002000 8c000005 00402010 400500cd 0842d400 20160001 54000002 401102e0 |