On Target NMDZ1_HUMAN 0.18145162/CHEMBL248446
For the given ligand riluzole, we have found in our database that, being scored 0.18145162, the most similar ligand is CHEMBL248446. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL248446 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CCc1cc2NC(=O)C(=O)Nc2c(N(CCCOC)S(=O)(=O)C)c1Cl |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 0001c022 0000c804 40100106 41310620 200c0040 08000010 20008026 08401000 06400000 00480870 0c202004 40018800 82108c0c 00400001 819e1041 000e004c 0c240000 0a400404 08a00000 00004004 44140481 18048900 21800080 10610810 02046082 c0100600 000084c0 000000bc 04408202 00460002 00040000 004326e0 |