On Target PERM_HUMAN 0.16393442/CHEMBL4098162
For the given ligand riluzole, we have found in our database that, being scored 0.16393442, the most similar ligand is CHEMBL4098162. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL4098162 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CC(C)NCC(=O)c1nc2cc(F)ccc2[nH]1 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 0400000a 00000000 00100420 12000600 00040060 00004030 00000000 00000000 00000100 00400a40 01288004 4080a000 02008002 00501000 01020040 020c0005 00000000 08000000 00200000 00000200 40000000 18000220 21806020 00000010 01001000 00000000 00000000 00000003 00000004 00478801 40004000 20000280 |