On Target PDE5A_HUMAN 0.2881356/CHEMBL474228
For the given ligand riluzole, we have found in our database that, being scored 0.2881356, the most similar ligand is CHEMBL474228. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL474228 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CCOC(=O)c1sc(Nc2nc(cc(n2)N3CCC(O)CC3)N4CCC(O)CC4)nc1C |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 00030002 43000001 00100880 28080610 23000448 0000e000 0050a980 101688c8 30002100 000000d0 00200a04 50039800 0400800a 00210001 00022900 101c000c 01061000 02004080 00c10010 84a05201 80102000 140c2a80 219048c0 3031001c 020c1481 8c100000 00280401 300004c4 0528020d 044e2800 c0001000 042102c0 |