On Target SC6A4_HUMAN 0.2806324/CHEMBL3128178
For the given ligand riluzole, we have found in our database that, being scored 0.2806324, the most similar ligand is CHEMBL3128178. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL3128178 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | O[C@@H]([C@H]1CC[C@@H](Cc2ccc(NC(=O)[C@@H]3CCc4scnc34)cc2)N1)c5cccnc5 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 00034002 01004900 00504902 43890614 280c11a0 00006010 035020c0 18008009 00500980 00492ac0 08388a04 50819000 04008802 01b09801 014a2040 002c000c 10040200 0e000084 08602418 80004201 40100900 18a886d0 23806000 d1510015 02041000 8e000500 08200000 10000184 04428006 04060003 c8027000 20412610 |