On Target PPARG_HUMAN 0.34246576/CHEMBL343459
For the given ligand riluzole, we have found in our database that, being scored 0.34246576, the most similar ligand is CHEMBL343459. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL343459 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | Cc1ncsc1CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c4ccccc4)C(=O)O)cc2 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 1402540a 00000808 20101908 00010616 200010e0 02090040 02442080 01108148 00c20800 00483840 08300a04 5000b000 04808002 00200001 01422041 000c200e 10048080 02000081 08400018 80020001 40100900 182a0a80 23004040 91410015 02041800 ac000080 08320000 40001084 040a8284 04060802 a0005000 20010600 |