On Target CHLE_HUMAN 0.22509225/CHEMBL3356950
For the given ligand riluzole, we have found in our database that, being scored 0.22509225, the most similar ligand is CHEMBL3356950. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL3356950 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | COc1ccc2nc3CCCCc3c(NCCCNC4=C(Cl)C(=O)c5ccccc5C4=O)c2c1 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 0042400a 01004c08 6010410a 10810610 20041160 00808040 2308a1a1 1000240b 91400c80 00980972 08308004 40c0a000 02008826 00600800 81020041 0204004e 10058a04 06101084 08332408 00020a01 64900900 782683c8 2080c000 81400094 04042000 8c000001 08448040 00041580 04588216 00861212 86044080 60022640 |