On Target PDE4B_HUMAN 0.26877472/CHEMBL199015
For the given ligand riluzole, we have found in our database that, being scored 0.26877472, the most similar ligand is CHEMBL199015. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL199015 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | OC(c1ncc(s1)[C@@H](Cc2ccc[n+]([O-])c2)c3ccc(OC(F)F)c(OC4CC4)c3)(C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 0c02000a 4a904108 24104108 10a10214 00045010 42020000 02043080 0101a009 00401a08 00480950 08108a04 d0408020 008058d2 214008c0 01422001 020ca01d 00018800 02804086 00386410 80020201 4c802901 483d8480 21900008 18530010 02041100 8c000000 08120900 d0440004 02420284 0002101a 48000000 a0010750 |