On Target ACM4_HUMAN 0.22748815/CHEMBL353290
For the given ligand riluzole, we have found in our database that, being scored 0.22748815, the most similar ligand is CHEMBL353290. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL353290 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CC(C1=C(CCN(C)C)Cc2ccc(F)cc12)c3ccccn3 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 0208000a 09000000 04104383 12010600 02040020 00800012 80080081 00000403 00100800 00b829c0 08308004 51818000 00004800 00201240 00820022 02048004 00000400 061000c0 00200008 00100801 40100100 18108000 20c0c800 00500010 01000800 80000009 80402040 50000001 00500004 00868c02 04000000 20000700 |