On Target NEP_HUMAN 0.29032257/CHEMBL37820
For the given ligand riluzole, we have found in our database that, being scored 0.29032257, the most similar ligand is CHEMBL37820. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL37820 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | OC(=O)CC[C@@H](Cc1ccc(cc1)c2ccccc2)C(=O)Nc3nc(CC(=O)O)cs3 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 00032002 01000200 00181902 04010600 090800c0 00000400 00108100 30328208 00000900 200e08c2 0830aa00 50019c00 0c008038 01a00001 00022000 001c000c 00020000 02004080 04402018 10a04001 00000100 18c02e80 71000800 40510010 00005880 8c000400 00200000 10000444 0000401e 040e200b 00007000 24010700 |