On Target HPGDS_HUMAN 0.2361111/CHEMBL264951
For the given ligand riluzole, we have found in our database that, being scored 0.2361111, the most similar ligand is CHEMBL264951. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL264951 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | COc1ccccc1c2csc(Nc3ccc(cc3)C(=O)O)n2 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 00070002 00000808 a0000908 80090200 01001000 00004000 42000100 100a8088 00004300 00004840 80200a04 50008000 0400800a 00108001 01022041 000c200c 00068000 12106080 0c000018 30a20000 40000000 08022aa0 a0004800 80410005 00801080 8c100000 30200000 000104e4 0014c30c 140e2000 e0000800 04010002 |