On Target ALDR_HUMAN 0.26086956/CHEMBL372902
For the given ligand riluzole, we have found in our database that, being scored 0.26086956, the most similar ligand is CHEMBL372902. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL372902 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | OC(=O)Cn1cc(Cc2nc3c(F)cccc3s2)c4ccccc14 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 0003040a 10000800 0010010a 56010618 000c5020 00088010 00002080 0001f00b 00400040 004818c0 08008a04 d081a000 00008870 04401000 000220c0 060c448c 00000800 c2800083 0030041c 40000000 40000800 58098a98 22800002 86510016 02042002 8c000000 48100000 10000015 00000504 40069002 20048200 20410620 |