On Target NOS2_HUMAN 0.22727273/CHEMBL490560
For the given ligand riluzole, we have found in our database that, being scored 0.22727273, the most similar ligand is CHEMBL490560. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL490560 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | Cc1ncsc1C(=O)N(CC2=CC(=O)Nc3cccc(F)c23)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 1002c002 00800800 00104902 13010618 00040000 00008070 08404080 0200d408 06000000 40202860 04280a04 5000c800 82008806 00701021 00122460 00040004 01063008 02000084 08200010 84084200 d0121000 08088f88 20812000 f0510008 03047000 cc000003 00304020 80000097 08048104 04078001 80048020 80030220 |