On Target CXCR1_HUMAN 0.20437956/CHEMBL401893
For the given ligand riluzole, we have found in our database that, being scored 0.20437956, the most similar ligand is CHEMBL401893. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL401893 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CCC(NC1=C(Nc2cccc(C(=O)N(C)C)c2O)C(=O)C1=O)c3nccs3 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 1043400a 00000808 62100102 10012e00 26008001 68122000 020000a0 2241f50b 05a00440 005008d0 00298a04 d002b000 0a0088d2 00200020 81826040 1004614c 00051001 26008086 08230218 20020201 48101880 d8138680 20000000 00418014 06141000 8c000080 20400010 900c05c4 20508306 20861001 8c045420 60012210 |