On Target 5HT1B_HUMAN 0.2300885/CHEMBL1632219
For the given ligand riluzole, we have found in our database that, being scored 0.2300885, the most similar ligand is CHEMBL1632219. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL1632219 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | Cc1ccc2c(cccc2n1)N3CCN(CCc4cccc(NC(=O)c5scnc5C)c4)CC3 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 10024002 00000000 40104922 14010618 04040020 00008000 0040c080 00009008 10400080 00080a50 08280a04 50008000 00008802 00703021 00022040 02040004 01041000 02000080 08200010 84000200 d4121000 382c8e88 20812021 b341001a 02041000 8c000002 002080c0 80000084 0c448004 04060003 80040020 80010640 |