On Target TLR4_HUMAN 0.1814346/CHEMBL375048
For the given ligand riluzole, we have found in our database that, being scored 0.1814346, the most similar ligand is CHEMBL375048. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL375048 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CCOC(=O)C1=CCCCCC1S(=O)(=O)Nc2ccc(F)cc2Cl |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 00018022 25000000 02100002 02310300 90080000 00000890 220202a0 08080402 01200000 00100840 40003404 40029800 0612840e 00861005 80080540 000a1048 00c20020 00000800 20416010 00e06001 40000020 8a000b85 21009500 02040030 00203480 00004400 00404000 c000001d 00402200 40068000 24020000 010302f0 |