On Target OPRX_HUMAN 0.25821596/CHEMBL511373
For the given ligand riluzole, we have found in our database that, being scored 0.25821596, the most similar ligand is CHEMBL511373. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL511373 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | OC1(CC2CCC(C1)N2C(c3ccccc3Cl)c4ccccc4Cl)c5cncs5 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 00028002 01000100 00100102 00810614 00080300 00000010 020020a0 23009008 00400900 804808c0 08200a00 50018800 02000806 00800800 00402400 000c000c 00000000 02000080 00c02010 80004201 00002c00 18088190 21100080 10510014 02042001 ee000204 00000001 d0001384 000a0182 0006000a ac060000 00032610 |