On Target 5HT2B_HUMAN 0.30769232/CHEMBL1836317
For the given ligand riluzole, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL1836317. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL1836317 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CS(=O)(=O)NC[C@@H]1CC[C@H](CC1)Nc2nc3c(CCSc4ccccc34)s2 |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 04030002 01800201 80120980 01310614 01000060 40000020 40402180 103a8088 00400000 214948c2 00602a00 7001a400 06018008 00340001 a2422841 0014c004 0c022400 22206080 26002018 c0a04011 c0000800 180820b0 60804800 14514019 22843080 8c100004 20200000 1400047c 0402401e 040e2020 1006d804 05250270 |