On Target MK03_HUMAN 0.16606498/CHEMBL213618
For the given ligand riluzole, we have found in our database that, being scored 0.16606498, the most similar ligand is CHEMBL213618. Check out the elaboration below.
| riluzole (Given Ligand) | CHEMBL213618 (Similar Ligand) |
|---|---|
| Nc2nc1C/C=C(OC(F)(F)F)\Cc1s2 | CNc1nccc(n1)c2ccc(s2)C(=O)N[C@H](CN)Cc3ccc(Cl)cc3Cl |
|
|
|
|
|
|
| 0003040a 00000000 0c100e80 00010096 09000040 00800010 20402180 0002a44b 81420000 00dc3140 01808a00 5000a000 8000c008 00200041 02422001 000c800c 10000c00 02020080 00100050 80204000 00000800 00880080 2100c800 54010010 02045000 8c000400 00600080 c0000004 1203420c 04162800 24800000 200302c0 | 0001a042 00003a10 82110101 40050600 01000204 00024020 000c2080 1e0e500e 00800d80 000908c1 08328204 60008b80 82008836 00100420 00022400 000c0205 03071000 0200600c 04610000 10a00209 00001500 7d22a780 34802840 9b40011c 02002100 c4000200 01040000 80002264 0c18031c 0046080b e0000800 00c306a1 |