On Target COMT_HUMAN 0.014084507/CHEMBL3920565
For the given ligand Aspirin, we have found in our database that, being scored 0.014084507, the most similar ligand is CHEMBL3920565. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3920565 (Similar Ligand) |
|---|---|
| CC | OC1=CN=C(NC1=O)c2ccc(cc2)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00000008 40100100 10010600 00000028 00004004 00801c00 00080000 06000100 10000870 00008004 40008000 00008000 01400001 00020000 000c000c 00000020 0200a000 00400000 00400000 00000000 08000000 20800040 00500000 00000802 80000200 20000100 90040000 00004004 00420400 40100800 40000280 |