On Target CASP1_HUMAN 0.016949153/CHEMBL252716
For the given ligand Aspirin, we have found in our database that, being scored 0.016949153, the most similar ligand is CHEMBL252716. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL252716 (Similar Ligand) |
|---|---|
| CC | COC(=O)[C@@]12C(=C)[C@@](C)(C[C@@H]3[C@]1(C)CC=C4C(C)(C)C(=O)C[C@@H](O)[C@@]34C)C(=O)[C@](C)(O)C2=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00050000 81000000 00800800 00010100 00280000 00200000 00000040 00000402 00000140 00128008 00000200 4000d000 14028028 00800000 00000404 00080008 00820000 00000020 12402000 00008001 00000000 00000a00 01008000 00000010 00200000 00000000 00404200 80000000 00000200 00000000 24020000 00000000 |