On Target NEP_HUMAN 0.022222223/CHEMBL211529
For the given ligand Aspirin, we have found in our database that, being scored 0.022222223, the most similar ligand is CHEMBL211529. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL211529 (Similar Ligand) |
|---|---|
| CC | CCCC(CC1(CCCC1)C(=O)N[C@@H]2CCCC[C@@H]2CCC)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01001000 00100000 00000400 00080000 00000000 00000000 20000000 00000000 00020080 00200000 40011000 0400803a 01800000 00000000 00080008 00000000 00000000 02402000 00000201 00000000 10040e10 01000000 00100018 00000000 00000000 00000000 10000000 00000000 01040001 00020000 00002200 |