On Target NMDZ1_HUMAN 0.12796208/CHEMBL248438
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.12796208, the most similar ligand is CHEMBL248438. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL248438 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CS(=O)(=O)N(CC1CCCO1)c2c(Cl)c(Cl)cc3NC(=O)C(=O)Nc23 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 0001c022 01008004 00101006 81310620 200c00c0 08002010 08008026 08401000 06040000 004008e0 0c242004 40018800 02108c0c 01400001 80de1049 000e004c 0c040000 28000400 08600000 09004001 401400a1 18048900 33800000 50310850 920064a2 40100400 18008480 100200ac 04008200 00460000 00040000 004322f0 |