On Target ACES_HUMAN 0.33613446/CHEMBL3586200
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.33613446, the most similar ligand is CHEMBL3586200. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL3586200 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | C[C@@]12CC[C@@H]3[C@](C)(CC[C@H](OC(=O)CCc4ccc(O)cc4)[C@]3(C)C(=O)O)[C@H]1CC[C@H]5C(=CC[C@H]6[C@@](C)(CO)[C@H](O)CC[C@]56C)C2 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00010040 01000008 20000100 00010300 000c0040 00200000 02000000 00000402 00000800 01180848 08100000 40009000 1402800a 00800000 00000400 00081008 00820000 02000020 03402008 00020001 00000120 08000a00 01008040 00400010 00200c00 80000000 0052c000 80001000 00000200 0002000a 24020000 00000400 |