On Target PDE5A_HUMAN 0.16574585/CHEMBL190364
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.16574585, the most similar ligand is CHEMBL190364. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL190364 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCOC(=O)CC(NC(=O)c1cccc(COc2cc(O)c(cc2CC)C(=O)C)c1)C(=O)OCC |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 04048009 00005808 20100109 80010700 00201081 80024000 52040000 02001200 00000100 00080a40 48200000 4000b000 0e808802 00090000 01001409 0a083008 10220000 02008101 10c00010 40020a01 00000020 18128e20 13000080 00c0101c 00005401 c0002000 08920000 80800001 00010302 00060003 e0044004 00000600 |