On Target TRPV1_RAT 0.44055945/CHEMBL319078
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.44055945, the most similar ligand is CHEMBL319078. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL319078 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | C[C@@H]1C[C@]2(OC3(Cc4ccccc4)OC2[C@@H]5C=C(COC(=O)Cc6ccccc6)C[C@@]7(O)[C@@H](C=C(C)C7=O)C15O3)C(=C)C |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00050040 81000000 00000900 80810300 00380040 00800804 02802a80 28000442 01200000 01180868 48000200 4000d000 05028028 02800000 40040404 00289008 08820000 02000100 3741a010 0200a001 00110020 08001a80 0500a000 08400010 00201480 80200400 00404202 a4010020 00000200 80020002 24a22000 00800410 |