On Target PAR1_HUMAN 0.3219178/CHEMBL234804
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.3219178, the most similar ligand is CHEMBL234804. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL234804 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | C[C@H]1OC(=O)[C@@H]2C=C3CCCC[C@H]3[C@H](\C=C\c4cccc(C)n4)[C@H]12 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00050042 81000000 00804b00 90010700 000d0021 04000000 800000c0 0800040a 00000040 08108048 00000204 40409000 04028808 00800000 010a0406 020c100c 00820400 0a000020 02602000 0000a001 40000020 08009a00 2180a020 00410010 01200400 82000000 00406240 c0009200 00400204 00060002 24020000 00000000 |