On Target AMPN_HUMAN 0.20114942/CHEMBL1782887
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.20114942, the most similar ligand is CHEMBL1782887. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL1782887 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | N[C@H]1CC\C=C\CC[C@H](NC(=O)C[C@H](Cc2ccc(O)cc2)NC1=O)C(=O)NCc3ccccc3CC(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00010008 01803408 20900902 14010600 00000040 00000000 02000000 2200140e 10100880 001989e0 08300000 4001b000 0f028882 00202000 c0040480 00080008 08004000 02000001 00010010 00020201 80020100 382c8e00 0100c001 83500018 00201000 c0000100 00524000 90000000 0c000100 00060813 24046000 00402600 |