On Target AOFA_HUMAN 0.33076924/CHEMBL332223
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.33076924, the most similar ligand is CHEMBL332223. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL332223 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CCOC(=O)C1=Cc2ccccc2CC1=O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 10090000 01000000 00000302 00110300 200c0000 00200000 82000080 00000400 01800900 00180842 48102000 40009000 15028000 00200000 40000022 0008100a 00820400 02000000 20418018 00000001 00100120 08000a00 0100c020 00400010 01001400 80000101 00402000 c0000400 00400200 00020002 04002020 00410410 |