On Target ADRB2_HUMAN 0.22123894/CHEMBL1714856
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.22123894, the most similar ligand is CHEMBL1714856. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL1714856 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | COC(=O)C1=C(C[C@@H]2CC[C@H]1N2C(=O)NCc3cccc(F)c3)c4cccc(OCc5ccccc5)c4 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 04010010 4b809208 2010030a 02010f00 00081040 40004810 82180184 3a003402 01800900 015828c8 49300000 51119000 0c82990a 20a11080 01000423 020c0108 20a24400 02000541 40c9a05a 00820201 80000100 18158eb0 010080a0 00d01018 01213083 80002401 00486000 d0010501 00400302 0006850b 6c0e0000 82002710 |