On Target PPARG_HUMAN 0.46875/CHEMBL2178586
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.46875, the most similar ligand is CHEMBL2178586. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL2178586 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CC[C@H](C[C@@]1(CC)OC(=O)C(=C1)CC)\C=C\C(=O)C |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00040040 81000000 00000100 80010300 00180000 00000800 02000080 08000402 01000000 00100000 40000000 40009000 04028000 00000000 00000400 00081008 00820010 00000000 00412010 00002001 00000020 00000a80 01008000 00000010 00201400 00000400 00404200 80000000 00000200 00000002 24020000 00800010 |