On Target CASP1_HUMAN 0.46268657/CHEMBL252921
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.46268657, the most similar ligand is CHEMBL252921. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL252921 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | COC(=O)[C@]12[C@@H]3[C@H](O[C@@H](C)C1=O)OC(=O)[C@]3(C)C[C@@H]4[C@]2(C)CC=C5C(=CC(=O)OC5(C)C)[C@@]46CO6 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00050040 81040000 00000900 00010b00 c0380080 00200801 02000a80 28002402 01200100 00128028 40000200 4000d001 14028028 22820000 00080404 0828100c 00820000 80000100 3249a090 0000a001 20000020 00010a80 0140a000 00000016 00201480 00001400 00406000 a4000000 00000242 00000002 24220000 00800010 |