On Target CHLE_HUMAN 0.38405797/CHEMBL492233
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.38405797, the most similar ligand is CHEMBL492233. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL492233 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | O=C(NCc1ccccc1)O[C@H]2CO[C@@H]3[C@@H](CO[C@H]23)OC(=O)\C=C\c4ccccc4 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00040040 01c00801 00000508 80010700 002800c0 00000000 82000080 82001440 01802200 01000840 40200000 40008010 0c008800 02800100 00080002 001a9008 00820400 02000000 3141a818 00000001 80000020 18008e10 05000000 0840001c 00001400 80001002 00402000 c0200460 00400300 0006000b 84040000 00000210 |