On Target BACE1_HUMAN 0.33620688/CHEMBL261063
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.33620688, the most similar ligand is CHEMBL261063. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL261063 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | CC(=CCC\C(=C\CC\C(=C\CC\C(=C\Cc1cc(O)cc(C)c1O)\C)\C)\C(=O)O)C |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00010000 43000408 20000100 00010202 00090001 00800000 02000081 08000602 01040000 00988848 08000000 40409000 04028022 00000000 00000400 00082008 00000000 02100000 00610010 00020a01 00000000 08000a80 01008000 00400010 00201000 80000400 00484000 80000000 00000000 00020002 04000000 00000400 |