On Target NEP_HUMAN 0.3063063/CHEMBL434492
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.3063063, the most similar ligand is CHEMBL434492. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL434492 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | COCCOC[C@H](CC1(CCCC1)C(=O)N[C@@H]2CC[C@@H](CC2)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00010000 01001000 00100000 00010500 000c0040 00200000 00000000 20000040 00002000 01020080 00200000 40019000 1400803a 01800000 00000000 00089008 00800000 00000000 03402000 00000201 00000020 10040e10 05000000 08100018 00000400 00000000 00000000 10000020 00000200 01040001 00020000 00002200 |