On Target NOS1_HUMAN 0.18181819/CHEMBL106820
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL106820. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL106820 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | N[C@@H](CCCNC(=N)CC=C)C(=O)O |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00810000 09000000 00100000 00000400 00080000 00000000 00080000 20000400 00200200 0010008b 00210000 40033000 04008012 01000000 00000000 00180008 00000000 00000000 00400000 00000201 00000000 10000a00 03000000 00100010 00000000 00000000 40000000 10000000 00000010 00040000 84000000 00002200 |