On Target NK1R_HUMAN 0.26174498/CHEMBL435564
For the given ligand (-)-TAN-2483B, we have found in our database that, being scored 0.26174498, the most similar ligand is CHEMBL435564. Check out the elaboration below.
| (-)-TAN-2483B (Given Ligand) | CHEMBL435564 (Similar Ligand) |
|---|---|
| [H][C@@]2(C)OC(=O)/C1=C/[C@@H](O)[C@@H](/C=C/C)O[C@@]12[H] | Cc1cc(C)cc(COC2C3CCN(CC3)/C/2=C/c4ccccc4)c1 |
|
|
|
|
|
|
| 00050040 01000000 00000d08 00010200 000d0040 00200800 02000280 28000442 01002000 01100000 40000200 40409001 1c028000 00000000 00080004 000a8008 00020000 00000000 21410010 00008001 20000020 10001a80 0500a000 08000010 00201400 00001400 00402000 80000020 00000202 00000000 04000000 00000010 | 00400000 01000000 00100b00 80010700 00100091 00004000 820002a0 20000400 00000500 001008c0 40201200 50018000 04020002 00010000 0008140a 02081048 10000400 12004000 20410018 50000201 00000020 38000020 13008020 00500010 05001400 80002000 00486200 d0040521 00400200 00060000 44000004 02000a10 |